CAS 53843-90-6 appears in our catalog under these names: D–Proline Benzyl Ester Hydrochloride, H-D-Pro-OBzl*HCl, D-Proline Benzyl Ester Hydrochloride, >98.0%(HPLC)(N), H-D-Pro-OBzl.HCl, 96%, 96%, H-D-Pro-OBzl.HCl, 96%. Offered by: GLPBio, Iris Biotech, TCI, Chemat, Fluorochem. Available pack sizes: 25g, 5g, 1g, 10g, 100g, 500g.
Benzyl (2R)-pyrrolidine-2-carboxylate;hydrochloride (CAS 53843-90-6) is a chemical compound with the molecular formula C12H16ClNO2 and a molecular weight of 241.71 g/mol. IUPAC name: benzyl (2R)-pyrrolidine-2-carboxylate;hydrochloride. InChIKey: NEDMOHHWRPHBAL-RFVHGSKJSA-N.
| Molecular formula | C12H16ClNO2 |
|---|---|
| Molecular weight | 241.71 g/mol |
| IUPAC name | benzyl (2R)-pyrrolidine-2-carboxylate;hydrochloride |
| InChIKey | NEDMOHHWRPHBAL-RFVHGSKJSA-N |
| SMILES | C1C[C@@H](NC1)C(=O)OCC2=CC=CC=C2.Cl |
Computed by PubChem (NCBI)