CAS 53897-95-3 is the registry number for 1-Phenyl-1H-1,3-benzodiazol-5-amine. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
1-phenylbenzimidazol-5-amine (CAS 53897-95-3) is a chemical compound with the molecular formula C13H11N3 and a molecular weight of 209.25 g/mol. IUPAC name: 1-phenylbenzimidazol-5-amine. InChIKey: JSQMNGQWESPAOF-UHFFFAOYSA-N.
| Molecular formula | C13H11N3 |
|---|---|
| Molecular weight | 209.25 g/mol |
| IUPAC name | 1-phenylbenzimidazol-5-amine |
| InChIKey | JSQMNGQWESPAOF-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N2C=NC3=C2C=CC(=C3)N |
Computed by PubChem (NCBI)