Products 53936-94-0

CAS 53936-94-0 is the registry number for Methyl 1,4-dihydroquinoline-3-carboxylate. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

Methyl 1,4-dihydroquinoline-3-carboxylate (CAS 53936-94-0) is a chemical compound with the molecular formula C11H11NO2 and a molecular weight of 189.21 g/mol. IUPAC name: methyl 1,4-dihydroquinoline-3-carboxylate. InChIKey: FQLQTNUWLFCKBJ-UHFFFAOYSA-N.

Identity
Molecular formulaC11H11NO2
Molecular weight189.21 g/mol
IUPAC namemethyl 1,4-dihydroquinoline-3-carboxylate
InChIKeyFQLQTNUWLFCKBJ-UHFFFAOYSA-N
SMILESCOC(=O)C1=CNC2=CC=CC=C2C1

Computed by PubChem (NCBI)