CAS 5394-37-6 is the registry number for 5-Phenyl-5-propylimidazolidine-2,4-dione. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
5-phenyl-5-propylimidazolidine-2,4-dione (CAS 5394-37-6) is a chemical compound with the molecular formula C12H14N2O2 and a molecular weight of 218.25 g/mol. IUPAC name: 5-phenyl-5-propylimidazolidine-2,4-dione. InChIKey: NLEOJRZVVDXEBJ-UHFFFAOYSA-N.
| Molecular formula | C12H14N2O2 |
|---|---|
| Molecular weight | 218.25 g/mol |
| IUPAC name | 5-phenyl-5-propylimidazolidine-2,4-dione |
| InChIKey | NLEOJRZVVDXEBJ-UHFFFAOYSA-N |
| SMILES | CCCC1(C(=O)NC(=O)N1)C2=CC=CC=C2 |
Computed by PubChem (NCBI)