CAS 5396-30-5 appears in our catalog under these names: 9-Chloro-1,2,3,4-tetrahydroacridine, >95% (HPLC), 9-Chloro-1,2,3,4-tetrahydroacridine, >98.0%(GC), 9-CHLORO-1,2,3,4-TETRAHYDROACRIDINE, 96%, 9-Chloro-1,2,3,4-tetrahydroacridine, 95%. Offered by: TRC, TCI, Fluorochem, Ambeed. Available pack sizes: 100mg, 1g, 500mg, 200mg, 250mg, 5g.
9-chloro-1,2,3,4-tetrahydroacridine (CAS 5396-30-5) is a chemical compound with the molecular formula C13H12ClN and a molecular weight of 217.69 g/mol. IUPAC name: 9-chloro-1,2,3,4-tetrahydroacridine. InChIKey: IYPJWKLHPNECFJ-UHFFFAOYSA-N.
| Molecular formula | C13H12ClN |
|---|---|
| Molecular weight | 217.69 g/mol |
| IUPAC name | 9-chloro-1,2,3,4-tetrahydroacridine |
| InChIKey | IYPJWKLHPNECFJ-UHFFFAOYSA-N |
| SMILES | C1CCC2=NC3=CC=CC=C3C(=C2C1)Cl |
Computed by PubChem (NCBI)