Products 5397-75-1
CAS 5397-75-1 appears in our catalog under these names: 2,6-Diethoxyisonicotinic acid, 95%, 2,6-diethoxyisonicotinic acid, 95+%, 2,6-Diethoxyisonicotinic acid, 95%+, 95%+, 2,6-Diethoxyisonicotinic acid. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 10g, 25g, 5g, 250mg, 1g, 100mg.
2,6-diethoxypyridine-4-carboxylic acid (CAS 5397-75-1) is a chemical compound with the molecular formula C10H13NO4 and a molecular weight of 211.21 g/mol. IUPAC name: 2,6-diethoxypyridine-4-carboxylic acid. InChIKey: OFJQIZRFVUOCFM-UHFFFAOYSA-N.
| Molecular formula | C10H13NO4 |
|---|---|
| Molecular weight | 211.21 g/mol |
| IUPAC name | 2,6-diethoxypyridine-4-carboxylic acid |
| InChIKey | OFJQIZRFVUOCFM-UHFFFAOYSA-N |
| SMILES | CCOC1=CC(=CC(=N1)OCC)C(=O)O |
Computed by PubChem (NCBI)