CAS 53984-12-6 is the registry number for 1-(3,4-Dichlorophenyl)propan-1-ol, 97%. Offered by: AmBeed. Available pack sizes: 1g.
1-(3,4-dichlorophenyl)propan-1-ol (CAS 53984-12-6) is a chemical compound with the molecular formula C9H10Cl2O and a molecular weight of 205.08 g/mol. IUPAC name: 1-(3,4-dichlorophenyl)propan-1-ol. InChIKey: PJYGECCAJOYJMK-UHFFFAOYSA-N.
| Molecular formula | C9H10Cl2O |
|---|---|
| Molecular weight | 205.08 g/mol |
| IUPAC name | 1-(3,4-dichlorophenyl)propan-1-ol |
| InChIKey | PJYGECCAJOYJMK-UHFFFAOYSA-N |
| SMILES | CCC(C1=CC(=C(C=C1)Cl)Cl)O |
Computed by PubChem (NCBI)