CAS 837417-11-5 appears in our catalog under these names: (1R)-1-(3,4-Dichlorophenyl)propan-1-ol, 95%, (1R)-1-(3,4-Dichlorophenyl)propan-1-ol. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
(1R)-1-(3,4-dichlorophenyl)propan-1-ol (CAS 837417-11-5) is a chemical compound with the molecular formula C9H10Cl2O and a molecular weight of 205.08 g/mol. IUPAC name: (1R)-1-(3,4-dichlorophenyl)propan-1-ol. InChIKey: PJYGECCAJOYJMK-SECBINFHSA-N.
| Molecular formula | C9H10Cl2O |
|---|---|
| Molecular weight | 205.08 g/mol |
| IUPAC name | (1R)-1-(3,4-dichlorophenyl)propan-1-ol |
| InChIKey | PJYGECCAJOYJMK-SECBINFHSA-N |
| SMILES | CC[C@H](C1=CC(=C(C=C1)Cl)Cl)O |
Computed by PubChem (NCBI)