Products 539857-64-2
CAS 539857-64-2 is the registry number for WF-536. Offered by: MedChemExpress. Available pack sizes: Get quote.
4-[(1R)-1-aminoethyl]-N-pyridin-4-ylbenzamide;hydrochloride (CAS 539857-64-2) is a chemical compound with the molecular formula C14H16ClN3O and a molecular weight of 277.75 g/mol. IUPAC name: 4-[(1R)-1-aminoethyl]-N-pyridin-4-ylbenzamide;hydrochloride. InChIKey: DVCLJVOQDUIPOT-HNCPQSOCSA-N.
| Molecular formula | C14H16ClN3O |
|---|---|
| Molecular weight | 277.75 g/mol |
| IUPAC name | 4-[(1R)-1-aminoethyl]-N-pyridin-4-ylbenzamide;hydrochloride |
| InChIKey | DVCLJVOQDUIPOT-HNCPQSOCSA-N |
| SMILES | C[C@H](C1=CC=C(C=C1)C(=O)NC2=CC=NC=C2)N.Cl |
Computed by PubChem (NCBI)