CAS 54052-67-4 is the registry number for 6-Amino-1-isobutyl-3-methyl-5-nitroso-2,4-pyrimidinedione, >95% (HPLC). Offered by: TRC. Available pack sizes: 1g, 2,5g, 500mg.
6-amino-3-methyl-1-(2-methylpropyl)-5-nitrosopyrimidine-2,4-dione (CAS 54052-67-4) is a chemical compound with the molecular formula C9H14N4O3 and a molecular weight of 226.23 g/mol. IUPAC name: 6-amino-3-methyl-1-(2-methylpropyl)-5-nitrosopyrimidine-2,4-dione. InChIKey: PXWGPZUKJUEITG-UHFFFAOYSA-N.
| Molecular formula | C9H14N4O3 |
|---|---|
| Molecular weight | 226.23 g/mol |
| IUPAC name | 6-amino-3-methyl-1-(2-methylpropyl)-5-nitrosopyrimidine-2,4-dione |
| InChIKey | PXWGPZUKJUEITG-UHFFFAOYSA-N |
| SMILES | CC(C)CN1C(=C(C(=O)N(C1=O)C)N=O)N |
Computed by PubChem (NCBI)