Products 956040-37-2
CAS 956040-37-2 is the registry number for 2-(3,5-Dimethyl-4-nitro-1H-pyrazol-1-yl)-N-ethylacetamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(3,5-dimethyl-4-nitropyrazol-1-yl)-N-ethylacetamide (CAS 956040-37-2) is a chemical compound with the molecular formula C9H14N4O3 and a molecular weight of 226.23 g/mol. IUPAC name: 2-(3,5-dimethyl-4-nitropyrazol-1-yl)-N-ethylacetamide. InChIKey: OTKRYMSQYVFSGC-UHFFFAOYSA-N.
| Molecular formula | C9H14N4O3 |
|---|---|
| Molecular weight | 226.23 g/mol |
| IUPAC name | 2-(3,5-dimethyl-4-nitropyrazol-1-yl)-N-ethylacetamide |
| InChIKey | OTKRYMSQYVFSGC-UHFFFAOYSA-N |
| SMILES | CCNC(=O)CN1C(=C(C(=N1)C)[N+](=O)[O-])C |
Computed by PubChem (NCBI)