CAS 54146-51-9 appears in our catalog under these names: [5-(4-Aminophenyl)-2-furyl]methanol, 95%, (5-(4-Aminophenyl)-2-furyl)methanol. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 1g, 100mg, 500mg, 1000mg, 2000mg.
[5-(4-aminophenyl)furan-2-yl]methanol (CAS 54146-51-9) is a chemical compound with the molecular formula C11H11NO2 and a molecular weight of 189.21 g/mol. IUPAC name: [5-(4-aminophenyl)furan-2-yl]methanol. InChIKey: PGRYIWSQXZECGD-UHFFFAOYSA-N.
| Molecular formula | C11H11NO2 |
|---|---|
| Molecular weight | 189.21 g/mol |
| IUPAC name | [5-(4-aminophenyl)furan-2-yl]methanol |
| InChIKey | PGRYIWSQXZECGD-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC=C(O2)CO)N |
Computed by PubChem (NCBI)