CAS 54150-57-1 is the registry number for 2-Benzoyloxyacetyl chloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
(2-chloro-2-oxoethyl) benzoate (CAS 54150-57-1) is a chemical compound with the molecular formula C9H7ClO3 and a molecular weight of 198.60 g/mol. IUPAC name: (2-chloro-2-oxoethyl) benzoate. InChIKey: HZGAJRVMHROSBR-UHFFFAOYSA-N.
| Molecular formula | C9H7ClO3 |
|---|---|
| Molecular weight | 198.60 g/mol |
| IUPAC name | (2-chloro-2-oxoethyl) benzoate |
| InChIKey | HZGAJRVMHROSBR-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)OCC(=O)Cl |
Computed by PubChem (NCBI)