CAS 54334-96-2 is the registry number for Methyl 4,4-dimethyl-2,6-dioxocyclohexane-1-carboxylate, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
Methyl 4,4-dimethyl-2,6-dioxocyclohexane-1-carboxylate (CAS 54334-96-2) is a chemical compound with the molecular formula C10H14O4 and a molecular weight of 198.22 g/mol. IUPAC name: methyl 4,4-dimethyl-2,6-dioxocyclohexane-1-carboxylate. InChIKey: HGMJETQBLLVMTR-UHFFFAOYSA-N.
| Molecular formula | C10H14O4 |
|---|---|
| Molecular weight | 198.22 g/mol |
| IUPAC name | methyl 4,4-dimethyl-2,6-dioxocyclohexane-1-carboxylate |
| InChIKey | HGMJETQBLLVMTR-UHFFFAOYSA-N |
| SMILES | CC1(CC(=O)C(C(=O)C1)C(=O)OC)C |
Computed by PubChem (NCBI)