Products 5434-29-7
CAS 5434-29-7 appears in our catalog under these names: 3，5–Dimethyl–1H–pyrrole–2，4–dicarboxylic acid, 3,5-Dimethyl-1H-pyrrole-2,4-dicarboxylic acid, 95%, 95%, 3,5-Dimethyl-1H-pyrrole-2,4-dicarboxylic acid, 95%. Offered by: GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 1g, 250mg, 5g.
3,5-dimethyl-1H-pyrrole-2,4-dicarboxylic acid (CAS 5434-29-7) is a chemical compound with the molecular formula C8H9NO4 and a molecular weight of 183.16 g/mol. IUPAC name: 3,5-dimethyl-1H-pyrrole-2,4-dicarboxylic acid. InChIKey: LGAFIBCWNKPENX-UHFFFAOYSA-N.
| Molecular formula | C8H9NO4 |
|---|---|
| Molecular weight | 183.16 g/mol |
| IUPAC name | 3,5-dimethyl-1H-pyrrole-2,4-dicarboxylic acid |
| InChIKey | LGAFIBCWNKPENX-UHFFFAOYSA-N |
| SMILES | CC1=C(NC(=C1C(=O)O)C)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
3,5-dimethyl-1H-pyrrole-2,4-dicarboxylic acid, 3,5-dimethylpyrrole-2,4-dicarboxylic acid, 1H-Pyrrole-2,4-dicarboxylic acid, 3,5-dimethyl-, Sunitinib Impurity 24, 3,5-Dimethyl-2,4-pyrroledicarboxylic acid, Sunitinib Impurity 5, 2,4-Dimethyl-1H-pyrrole-3,5-dicarboxylic acid, 3,5-Dimethyl-1H-pyrrole-2,4-dicarboxylicacid, Oprea1_664742, 3,5-Dimethyl-1H-pyrrole-2,4-dicarboxylicaci