Products 543713-03-7
CAS 543713-03-7 is the registry number for N-Hydroxy-2-(trifluoromethoxy)benzene carboximidoyl chloride, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
(1Z)-N-hydroxy-2-(trifluoromethoxy)benzenecarboximidoyl chloride (CAS 543713-03-7) is a chemical compound with the molecular formula C8H5ClF3NO2 and a molecular weight of 239.58 g/mol. IUPAC name: (1Z)-N-hydroxy-2-(trifluoromethoxy)benzenecarboximidoyl chloride. InChIKey: LCZKSSFWTSEFBD-QPEQYQDCSA-N.
| Molecular formula | C8H5ClF3NO2 |
|---|---|
| Molecular weight | 239.58 g/mol |
| IUPAC name | (1Z)-N-hydroxy-2-(trifluoromethoxy)benzenecarboximidoyl chloride |
| InChIKey | LCZKSSFWTSEFBD-QPEQYQDCSA-N |
| SMILES | C1=CC=C(C(=C1)/C(=N/O)/Cl)OC(F)(F)F |
Computed by PubChem (NCBI)