Products 54381-42-9
CAS 54381-42-9 is the registry number for Cyproheptadine alpha-N-Oxide. Offered by: Mikromol. Available pack sizes: 100mg.
1-methyl-1-oxido-4-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaenylidene)piperidin-1-ium (CAS 54381-42-9) is a chemical compound with the molecular formula C21H21NO and a molecular weight of 303.4 g/mol. IUPAC name: 1-methyl-1-oxido-4-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaenylidene)piperidin-1-ium. InChIKey: AIAORTASLOWFGX-UHFFFAOYSA-N.
| Molecular formula | C21H21NO |
|---|---|
| Molecular weight | 303.4 g/mol |
| IUPAC name | 1-methyl-1-oxido-4-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaenylidene)piperidin-1-ium |
| InChIKey | AIAORTASLOWFGX-UHFFFAOYSA-N |
| SMILES | C[N+]1(CCC(=C2C3=CC=CC=C3C=CC4=CC=CC=C42)CC1)[O-] |
Computed by PubChem (NCBI)