Products 54405-45-7
CAS 54405-45-7 appears in our catalog under these names: 3-(3,4-diaminophenyl)propanoic acid, 3,4-Diaminobenzenepropanoic acid, 95%, 95%. Offered by: Chemat Brand, Chemat. Available pack sizes: on request, 25mg, 100mg, 250mg.
3-(3,4-diaminophenyl)propanoic acid (CAS 54405-45-7) is a chemical compound with the molecular formula C9H12N2O2 and a molecular weight of 180.20 g/mol. IUPAC name: 3-(3,4-diaminophenyl)propanoic acid. InChIKey: BKJRYXYXDRWDBP-UHFFFAOYSA-N.
| Molecular formula | C9H12N2O2 |
|---|---|
| Molecular weight | 180.20 g/mol |
| IUPAC name | 3-(3,4-diaminophenyl)propanoic acid |
| InChIKey | BKJRYXYXDRWDBP-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1CCC(=O)O)N)N |
Computed by PubChem (NCBI)