Products 5442-34-2

CAS 5442-34-2 is the registry number for Ethyl 2-phenylacetimidate hydrochloride, 97%. Offered by: AmBeed. Available pack sizes: 10g.

Structural formula: {0} (CAS {1})

Ethyl 2-phenylethanimidate;hydrochloride (CAS 5442-34-2) is a chemical compound with the molecular formula C10H14ClNO and a molecular weight of 199.68 g/mol. IUPAC name: ethyl 2-phenylethanimidate;hydrochloride. InChIKey: IWGUPOMJPZNXGC-UHFFFAOYSA-N.

Identity
Molecular formulaC10H14ClNO
Molecular weight199.68 g/mol
IUPAC nameethyl 2-phenylethanimidate;hydrochloride
InChIKeyIWGUPOMJPZNXGC-UHFFFAOYSA-N
SMILESCCOC(=N)CC1=CC=CC=C1.Cl

Computed by PubChem (NCBI)