CAS 5442-91-1 appears in our catalog under these names: 4-(Ethoxycarbonyl)-3,5-dimethyl-1h-pyrrole-2-carboxylic acid, 98%, 4–(Ethoxycarbonyl)–3,5–dimethyl–1h–pyrrole–2–carboxylic acid, 1H-Pyrrole-2,4-dicarboxylic acid, 3,5-dimethyl-, 4-ethyl ester, 98%, 98%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 10g, 5g, 1g, 25g, 100g, 500g, 100mg.
4-ethoxycarbonyl-3,5-dimethyl-1H-pyrrole-2-carboxylic acid (CAS 5442-91-1) is a chemical compound with the molecular formula C10H13NO4 and a molecular weight of 211.21 g/mol. IUPAC name: 4-ethoxycarbonyl-3,5-dimethyl-1H-pyrrole-2-carboxylic acid. InChIKey: DXKYHAPIBYYLJR-UHFFFAOYSA-N.
| Molecular formula | C10H13NO4 |
|---|---|
| Molecular weight | 211.21 g/mol |
| IUPAC name | 4-ethoxycarbonyl-3,5-dimethyl-1H-pyrrole-2-carboxylic acid |
| InChIKey | DXKYHAPIBYYLJR-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(NC(=C1C)C(=O)O)C |
Computed by PubChem (NCBI)