Products 544451-69-6

CAS 544451-69-6 is the registry number for 6-[(Butylamino)carbonyl]-3-cyclohexene-1-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

6-(butylcarbamoyl)cyclohex-3-ene-1-carboxylic acid (CAS 544451-69-6) is a chemical compound with the molecular formula C12H19NO3 and a molecular weight of 225.28 g/mol. IUPAC name: 6-(butylcarbamoyl)cyclohex-3-ene-1-carboxylic acid. InChIKey: XLQXGWOPKIGCQT-UHFFFAOYSA-N.

Identity
Molecular formulaC12H19NO3
Molecular weight225.28 g/mol
IUPAC name6-(butylcarbamoyl)cyclohex-3-ene-1-carboxylic acid
InChIKeyXLQXGWOPKIGCQT-UHFFFAOYSA-N
SMILESCCCCNC(=O)C1CC=CCC1C(=O)O

Computed by PubChem (NCBI)