Products 544667-79-0

CAS 544667-79-0 is the registry number for 5-((2-(Methoxycarbonyl)thiophen-3-yl)amino)-5-oxopentanoic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

5-[(2-methoxycarbonylthiophen-3-yl)amino]-5-oxopentanoic acid (CAS 544667-79-0) is a chemical compound with the molecular formula C11H13NO5S and a molecular weight of 271.29 g/mol. IUPAC name: 5-[(2-methoxycarbonylthiophen-3-yl)amino]-5-oxopentanoic acid. InChIKey: JBNBTYPSNNGLEY-UHFFFAOYSA-N.

Identity
Molecular formulaC11H13NO5S
Molecular weight271.29 g/mol
IUPAC name5-[(2-methoxycarbonylthiophen-3-yl)amino]-5-oxopentanoic acid
InChIKeyJBNBTYPSNNGLEY-UHFFFAOYSA-N
SMILESCOC(=O)C1=C(C=CS1)NC(=O)CCCC(=O)O

Computed by PubChem (NCBI)