Products 544686-14-8
CAS 544686-14-8 appears in our catalog under these names: 4-Chlorobenzene-d4-sulfonamide, 4-Chlorobenzene-2,3,5,6-d4-sulfonamide. Offered by: TRC, MedChemExpress. Available pack sizes: 250mg, 25mg, 250 mg, 25 mg, 50 mg, 100 mg.
4-chloro-2,3,5,6-tetradeuteriobenzenesulfonamide (CAS 544686-14-8) is a chemical compound with the molecular formula C6H6ClNO2S and a molecular weight of 195.66 g/mol. IUPAC name: 4-chloro-2,3,5,6-tetradeuteriobenzenesulfonamide. InChIKey: HHHDJHHNEURCNV-RHQRLBAQSA-N.
| Molecular formula | C6H6ClNO2S |
|---|---|
| Molecular weight | 195.66 g/mol |
| IUPAC name | 4-chloro-2,3,5,6-tetradeuteriobenzenesulfonamide |
| InChIKey | HHHDJHHNEURCNV-RHQRLBAQSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1S(=O)(=O)N)[2H])[2H])Cl)[2H] |
Computed by PubChem (NCBI)