Products 544701-14-6
CAS 544701-14-6 is the registry number for N-(2-Chloro-5-nitrophenyl)cyclohexylformamide. Offered by: Biosynth. Available pack sizes: 10mg, 5mg, 25mg.
N-(2-chloro-5-nitrophenyl)cyclohexanecarboxamide (CAS 544701-14-6) is a chemical compound with the molecular formula C13H15ClN2O3 and a molecular weight of 282.72 g/mol. IUPAC name: N-(2-chloro-5-nitrophenyl)cyclohexanecarboxamide. InChIKey: HSJCUTPJMFFQED-UHFFFAOYSA-N.
| Molecular formula | C13H15ClN2O3 |
|---|---|
| Molecular weight | 282.72 g/mol |
| IUPAC name | N-(2-chloro-5-nitrophenyl)cyclohexanecarboxamide |
| InChIKey | HSJCUTPJMFFQED-UHFFFAOYSA-N |
| SMILES | C1CCC(CC1)C(=O)NC2=C(C=CC(=C2)[N+](=O)[O-])Cl |
Computed by PubChem (NCBI)