Products 54491-43-9
CAS 54491-43-9 appears in our catalog under these names: Tubulin polymerization-IN-74, 98.79%, 3-(Phenylthio)-1H-indole, 95%, Tubulin polymerization-IN-74, 95%. Offered by: MedChemExpress, Fluorochem, Ambeed. Available pack sizes: Get quote, 100mg, 250mg, 1g, 5g, 10g.
3-phenylsulfanyl-1H-indole (CAS 54491-43-9) is a chemical compound with the molecular formula C14H11NS and a molecular weight of 225.31 g/mol. IUPAC name: 3-phenylsulfanyl-1H-indole. InChIKey: VHEGBLPHXSCODD-UHFFFAOYSA-N.
| Molecular formula | C14H11NS |
|---|---|
| Molecular weight | 225.31 g/mol |
| IUPAC name | 3-phenylsulfanyl-1H-indole |
| InChIKey | VHEGBLPHXSCODD-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)SC2=CNC3=CC=CC=C32 |
Computed by PubChem (NCBI)