Products 5450-75-9

CAS 5450-75-9 is the registry number for N-Tosylphenethylamine, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 5g, 10g, 25g, 50g, 100g.

Structural formula: {0} (CAS {1})

4-methyl-N-(2-phenylethyl)benzenesulfonamide (CAS 5450-75-9) is a chemical compound with the molecular formula C15H17NO2S and a molecular weight of 275.4 g/mol. IUPAC name: 4-methyl-N-(2-phenylethyl)benzenesulfonamide. InChIKey: HJIXJBGIPKKBSG-UHFFFAOYSA-N.

Identity
Molecular formulaC15H17NO2S
Molecular weight275.4 g/mol
IUPAC name4-methyl-N-(2-phenylethyl)benzenesulfonamide
InChIKeyHJIXJBGIPKKBSG-UHFFFAOYSA-N
SMILESCC1=CC=C(C=C1)S(=O)(=O)NCCC2=CC=CC=C2

Computed by PubChem (NCBI)