CAS 54503-17-2 appears in our catalog under these names: 3-Amino-3-(4-methoxy-3-methylphenyl)propanoic acid, 97%, 3-Amino-3-(4-methoxy-3-methylphenyl)propanoic acid, 97%, 97%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 50mg, 100mg, 250mg, 500mg, 1g, 2.5g.
3-amino-3-(4-methoxy-3-methylphenyl)propanoic acid (CAS 54503-17-2) is a chemical compound with the molecular formula C11H15NO3 and a molecular weight of 209.24 g/mol. IUPAC name: 3-amino-3-(4-methoxy-3-methylphenyl)propanoic acid. InChIKey: CFXUSSDPPUMXQG-UHFFFAOYSA-N.
| Molecular formula | C11H15NO3 |
|---|---|
| Molecular weight | 209.24 g/mol |
| IUPAC name | 3-amino-3-(4-methoxy-3-methylphenyl)propanoic acid |
| InChIKey | CFXUSSDPPUMXQG-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)C(CC(=O)O)N)OC |
Computed by PubChem (NCBI)