CAS 54574-82-2 appears in our catalog under these names: 2-(4-(DIBUTYLAMINO)-2-HYDROXYBENZOYL)- &, 2–(4–(dibutylamino)–2–hydroxybenzoyl)–benzoic acid, 2-(4-(Dibutylamino)-2-hydroxybenzoyl)benzoic acid, 98%, 2-(4-(Dibutylamino)-2-hydroxybenzoyl)benzoic acid 98%, 2-[4-(Dibutylamino)-2-hydroxybenzoyl]benzoic acid, 98%+(LC-MS), 98%+(LC-MS). Offered by: Sigma-Aldrich, GLPBio, Fluorochem, Ambeed, Chemat. Available pack sizes: 50G, 100g, 500g, 1000g, 25g, 1kg, 5g.
2-[4-(dibutylamino)-2-hydroxybenzoyl]benzoic acid (CAS 54574-82-2) is a chemical compound with the molecular formula C22H27NO4 and a molecular weight of 369.5 g/mol. IUPAC name: 2-[4-(dibutylamino)-2-hydroxybenzoyl]benzoic acid. InChIKey: QPNFUBAIQZJEPO-UHFFFAOYSA-N.
| Molecular formula | C22H27NO4 |
|---|---|
| Molecular weight | 369.5 g/mol |
| IUPAC name | 2-[4-(dibutylamino)-2-hydroxybenzoyl]benzoic acid |
| InChIKey | QPNFUBAIQZJEPO-UHFFFAOYSA-N |
| SMILES | CCCCN(CCCC)C1=CC(=C(C=C1)C(=O)C2=CC=CC=C2C(=O)O)O |
Computed by PubChem (NCBI)