CAS 54644-12-1 is the registry number for 5-Ethoxy-2-phenyloxazole-4-carboxylic acid, 97%. Offered by: AmBeed. Available pack sizes: 10g.
5-ethoxy-2-phenyl-1,3-oxazole-4-carboxylic acid (CAS 54644-12-1) is a chemical compound with the molecular formula C12H11NO4 and a molecular weight of 233.22 g/mol. IUPAC name: 5-ethoxy-2-phenyl-1,3-oxazole-4-carboxylic acid. InChIKey: FKTHAJTWXRSXRZ-UHFFFAOYSA-N.
| Molecular formula | C12H11NO4 |
|---|---|
| Molecular weight | 233.22 g/mol |
| IUPAC name | 5-ethoxy-2-phenyl-1,3-oxazole-4-carboxylic acid |
| InChIKey | FKTHAJTWXRSXRZ-UHFFFAOYSA-N |
| SMILES | CCOC1=C(N=C(O1)C2=CC=CC=C2)C(=O)O |
Computed by PubChem (NCBI)