CAS 5465-13-4 appears in our catalog under these names: Dinitrodurene, 95%, Dinitrodurene, Dinitrodurene, >97.0%(GC), Dinitrodurene, 97%, 1,2,4,5-Tetramethyl-3,6-dinitrobenzene, >=97%. Offered by: Combi-blocks, GLPBio, TCI, Thermo Scientific (Acros), Fluorochem. Available pack sizes: 25g, 1g, 5g.
1,2,4,5-tetramethyl-3,6-dinitrobenzene (CAS 5465-13-4) is a chemical compound with the molecular formula C10H12N2O4 and a molecular weight of 224.21 g/mol. IUPAC name: 1,2,4,5-tetramethyl-3,6-dinitrobenzene. InChIKey: AEPQXGFMAZTUEA-UHFFFAOYSA-N.
| Molecular formula | C10H12N2O4 |
|---|---|
| Molecular weight | 224.21 g/mol |
| IUPAC name | 1,2,4,5-tetramethyl-3,6-dinitrobenzene |
| InChIKey | AEPQXGFMAZTUEA-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C(=C1[N+](=O)[O-])C)C)[N+](=O)[O-])C |
Computed by PubChem (NCBI)