CAS 54675-03-5 is the registry number for 4-Hydroxy-7,8-dimethyl-2(1H)-quinolinone. Offered by: TRC. Available pack sizes: 2,5g.
4-hydroxy-7,8-dimethyl-1H-quinolin-2-one (CAS 54675-03-5) is a chemical compound with the molecular formula C11H11NO2 and a molecular weight of 189.21 g/mol. IUPAC name: 4-hydroxy-7,8-dimethyl-1H-quinolin-2-one. InChIKey: TVAYPCZDZPZKFR-UHFFFAOYSA-N.
| Molecular formula | C11H11NO2 |
|---|---|
| Molecular weight | 189.21 g/mol |
| IUPAC name | 4-hydroxy-7,8-dimethyl-1H-quinolin-2-one |
| InChIKey | TVAYPCZDZPZKFR-UHFFFAOYSA-N |
| SMILES | CC1=C(C2=C(C=C1)C(=CC(=O)N2)O)C |
Computed by PubChem (NCBI)