Products 5468-22-4

CAS 5468-22-4 is the registry number for 3-Iodo-4,5-dimethoxybenzoic acid 97%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

3-iodo-4,5-dimethoxybenzoic acid (CAS 5468-22-4) is a chemical compound with the molecular formula C9H9IO4 and a molecular weight of 308.07 g/mol. IUPAC name: 3-iodo-4,5-dimethoxybenzoic acid. InChIKey: YMKITVMTSMYARX-UHFFFAOYSA-N.

Identity
Molecular formulaC9H9IO4
Molecular weight308.07 g/mol
IUPAC name3-iodo-4,5-dimethoxybenzoic acid
InChIKeyYMKITVMTSMYARX-UHFFFAOYSA-N
SMILESCOC1=C(C(=CC(=C1)C(=O)O)I)OC

Computed by PubChem (NCBI)