CAS 5468-22-4 is the registry number for 3-Iodo-4,5-dimethoxybenzoic acid 97%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g.
3-iodo-4,5-dimethoxybenzoic acid (CAS 5468-22-4) is a chemical compound with the molecular formula C9H9IO4 and a molecular weight of 308.07 g/mol. IUPAC name: 3-iodo-4,5-dimethoxybenzoic acid. InChIKey: YMKITVMTSMYARX-UHFFFAOYSA-N.
| Molecular formula | C9H9IO4 |
|---|---|
| Molecular weight | 308.07 g/mol |
| IUPAC name | 3-iodo-4,5-dimethoxybenzoic acid |
| InChIKey | YMKITVMTSMYARX-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=CC(=C1)C(=O)O)I)OC |
Computed by PubChem (NCBI)