CAS 56221-41-1 appears in our catalog under these names: 2-Iodo-5,6-dimethoxybenzoic acid, 95%, 2-Iodo-5,6-dimethoxybenzoic acid. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 1g, 500mg, 1000mg, 2000mg.
6-iodo-2,3-dimethoxybenzoic acid (CAS 56221-41-1) is a chemical compound with the molecular formula C9H9IO4 and a molecular weight of 308.07 g/mol. IUPAC name: 6-iodo-2,3-dimethoxybenzoic acid. InChIKey: QKFFDXGRAQACBC-UHFFFAOYSA-N.
| Molecular formula | C9H9IO4 |
|---|---|
| Molecular weight | 308.07 g/mol |
| IUPAC name | 6-iodo-2,3-dimethoxybenzoic acid |
| InChIKey | QKFFDXGRAQACBC-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=C(C=C1)I)C(=O)O)OC |
Computed by PubChem (NCBI)