Products 84658-38-8
CAS 84658-38-8 is the registry number for 2-Hydroxy-3-(4-hydroxy-3-iodophenyl)propanoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-hydroxy-3-(4-hydroxy-3-iodophenyl)propanoic acid (CAS 84658-38-8) is a chemical compound with the molecular formula C9H9IO4 and a molecular weight of 308.07 g/mol. IUPAC name: 2-hydroxy-3-(4-hydroxy-3-iodophenyl)propanoic acid. InChIKey: VHYIKYNIOYFSLF-UHFFFAOYSA-N.
| Molecular formula | C9H9IO4 |
|---|---|
| Molecular weight | 308.07 g/mol |
| IUPAC name | 2-hydroxy-3-(4-hydroxy-3-iodophenyl)propanoic acid |
| InChIKey | VHYIKYNIOYFSLF-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1CC(C(=O)O)O)I)O |
Computed by PubChem (NCBI)