CAS 692204-84-5 appears in our catalog under these names: Ethyl 3,5-dihydroxy-4-iodobenzoate, 95%, ethyl 3,5–dihydroxy–4–iodobenzoate. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 100mg, 1g, 250mg, 5g.
Ethyl 3,5-dihydroxy-4-iodobenzoate (CAS 692204-84-5) is a chemical compound with the molecular formula C9H9IO4 and a molecular weight of 308.07 g/mol. IUPAC name: ethyl 3,5-dihydroxy-4-iodobenzoate. InChIKey: IDXUZOXYNCUBAM-UHFFFAOYSA-N.
| Molecular formula | C9H9IO4 |
|---|---|
| Molecular weight | 308.07 g/mol |
| IUPAC name | ethyl 3,5-dihydroxy-4-iodobenzoate |
| InChIKey | IDXUZOXYNCUBAM-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC(=C(C(=C1)O)I)O |
Computed by PubChem (NCBI)