CAS 5472-37-7 appears in our catalog under these names: Omeprazole Impurity 102, N–(2–Amino–4–methoxyphenyl)acetamide, N-(2-Amino-4-methoxyphenyl)acetamide. Offered by: Chemat Brand, GLPBio, Biosynth. Available pack sizes: on request, 100mg, 1g, 250mg, 5g, 2,5g.
N-(2-amino-4-methoxyphenyl)acetamide (CAS 5472-37-7) is a chemical compound with the molecular formula C9H12N2O2 and a molecular weight of 180.20 g/mol. IUPAC name: N-(2-amino-4-methoxyphenyl)acetamide. InChIKey: VUJSQJDPBROTSY-UHFFFAOYSA-N.
| Molecular formula | C9H12N2O2 |
|---|---|
| Molecular weight | 180.20 g/mol |
| IUPAC name | N-(2-amino-4-methoxyphenyl)acetamide |
| InChIKey | VUJSQJDPBROTSY-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=C(C=C(C=C1)OC)N |
Computed by PubChem (NCBI)