Products 54784-43-9

CAS 54784-43-9 is the registry number for Boc-Tyr(Bzl)-OH, 98%+,RG, 98%+,RG. Offered by: Chemat. Available pack sizes: 5g, 25g, 100g.

Structural formula: {0} (CAS {1})

2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(4-phenylmethoxyphenyl)propanoic acid (CAS 54784-43-9) is a chemical compound with the molecular formula C21H25NO5 and a molecular weight of 371.4 g/mol. IUPAC name: 2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(4-phenylmethoxyphenyl)propanoic acid. InChIKey: ZAVSPTOJKOFMTA-UHFFFAOYSA-N.

Identity
Molecular formulaC21H25NO5
Molecular weight371.4 g/mol
IUPAC name2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(4-phenylmethoxyphenyl)propanoic acid
InChIKeyZAVSPTOJKOFMTA-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)NC(CC1=CC=C(C=C1)OCC2=CC=CC=C2)C(=O)O

Computed by PubChem (NCBI)