CAS 54867-08-2 appears in our catalog under these names: Z-1,2-cis-ACHC-OH, 97%, Z-1,2-cis-ACHC-OH, 98%, 98%, Cbz-1,2-cis-ACHC-OH, 98%. Offered by: Combi-blocks, Chemat, Ambeed. Available pack sizes: 5g, 25g, 10g, 1g, 50mg, 100mg, 250mg.
Cis-(1R,2S)-2-(phenylmethoxycarbonylamino)cyclohexane-1-carboxylic acid (CAS 54867-08-2) is a chemical compound with the molecular formula C15H19NO4 and a molecular weight of 277.31 g/mol. IUPAC name: cis-(1R,2S)-2-(phenylmethoxycarbonylamino)cyclohexane-1-carboxylic acid. InChIKey: RPJMLWMATNCSIS-OLZOCXBDSA-N.
| Molecular formula | C15H19NO4 |
|---|---|
| Molecular weight | 277.31 g/mol |
| IUPAC name | cis-(1R,2S)-2-(phenylmethoxycarbonylamino)cyclohexane-1-carboxylic acid |
| InChIKey | RPJMLWMATNCSIS-OLZOCXBDSA-N |
| SMILES | C1CC[C@@H]([C@@H](C1)C(=O)O)NC(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)