CAS 54883-78-2 appears in our catalog under these names: 1-Phenyl-1H-benzo[d][1,2,3]triazol-5-amine, 97%, 97%, 1-Phenyl-1H-benzo[d][1,2,3]triazol-5-amine, 97%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
1-phenylbenzotriazol-5-amine (CAS 54883-78-2) is a chemical compound with the molecular formula C12H10N4 and a molecular weight of 210.23 g/mol. IUPAC name: 1-phenylbenzotriazol-5-amine. InChIKey: AASWUWVVKDFAMD-UHFFFAOYSA-N.
| Molecular formula | C12H10N4 |
|---|---|
| Molecular weight | 210.23 g/mol |
| IUPAC name | 1-phenylbenzotriazol-5-amine |
| InChIKey | AASWUWVVKDFAMD-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N2C3=C(C=C(C=C3)N)N=N2 |
Computed by PubChem (NCBI)