CAS 54896-72-9 is the registry number for N-(Aminocarbonyl)-D-phenylalanine, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
(2R)-2-(carbamoylamino)-3-phenylpropanoic acid (CAS 54896-72-9) is a chemical compound with the molecular formula C10H12N2O3 and a molecular weight of 208.21 g/mol. IUPAC name: (2R)-2-(carbamoylamino)-3-phenylpropanoic acid. InChIKey: IPWQOZCSQLTKOI-MRVPVSSYSA-N.
| Molecular formula | C10H12N2O3 |
|---|---|
| Molecular weight | 208.21 g/mol |
| IUPAC name | (2R)-2-(carbamoylamino)-3-phenylpropanoic acid |
| InChIKey | IPWQOZCSQLTKOI-MRVPVSSYSA-N |
| SMILES | C1=CC=C(C=C1)C[C@H](C(=O)O)NC(=O)N |
Computed by PubChem (NCBI)