CAS 549506-47-0 appears in our catalog under these names: 4-N-Boc-2-oxo-piperazine-1-acetic acid, 96%, 2–(4–(tert–Butoxycarbonyl)–2–oxopiperazin–1–yl)acetic acid, 1-Piperazineaceticacid, 4-[(1,1-dimethylethoxy)carbonyl]-2-oxo-, 98%, 98%, 2-(4-(tert-Butoxycarbonyl)-2-oxopiperazin-1-yl)acetic acid, 98.0%, 4-N-Boc-2-oxo-piperazine-1-acetic acid, 97%. Offered by: Combi-blocks, GLPBio, Chemat, MedChemExpress, Fluorochem. Available pack sizes: 250mg, 5g, 10g, 25g, 1g, 100mg, 5 g, 500 mg.
2-[4-[(2-methylpropan-2-yl)oxycarbonyl]-2-oxopiperazin-1-yl]acetic acid (CAS 549506-47-0) is a chemical compound with the molecular formula C11H18N2O5 and a molecular weight of 258.27 g/mol. IUPAC name: 2-[4-[(2-methylpropan-2-yl)oxycarbonyl]-2-oxopiperazin-1-yl]acetic acid. InChIKey: QHPTYSXSHRLTHM-UHFFFAOYSA-N.
| Molecular formula | C11H18N2O5 |
|---|---|
| Molecular weight | 258.27 g/mol |
| IUPAC name | 2-[4-[(2-methylpropan-2-yl)oxycarbonyl]-2-oxopiperazin-1-yl]acetic acid |
| InChIKey | QHPTYSXSHRLTHM-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCN(C(=O)C1)CC(=O)O |
Computed by PubChem (NCBI)