CAS 788153-44-6 appears in our catalog under these names: 2-(4-(tert-Butoxycarbonyl)piperazin-1-yl)-2-oxoacetic acid, 95+%, (4-Boc-piperazin-1-yl)-oxo-acetic acid. Offered by: Chemat Brand, Fluorochem. Available pack sizes: on request, 250mg.
2-[4-[(2-methylpropan-2-yl)oxycarbonyl]piperazin-1-yl]-2-oxoacetic acid (CAS 788153-44-6) is a chemical compound with the molecular formula C11H18N2O5 and a molecular weight of 258.27 g/mol. IUPAC name: 2-[4-[(2-methylpropan-2-yl)oxycarbonyl]piperazin-1-yl]-2-oxoacetic acid. InChIKey: WUVXPLRYCUOGTJ-UHFFFAOYSA-N.
| Molecular formula | C11H18N2O5 |
|---|---|
| Molecular weight | 258.27 g/mol |
| IUPAC name | 2-[4-[(2-methylpropan-2-yl)oxycarbonyl]piperazin-1-yl]-2-oxoacetic acid |
| InChIKey | WUVXPLRYCUOGTJ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCN(CC1)C(=O)C(=O)O |
Computed by PubChem (NCBI)