CAS 96165-58-1 is the registry number for tert-Butyl (S)-(3-(2,5-dioxooxazolidin-4-yl)propyl)carbamate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl N-[3-[(4S)-2,5-dioxo-1,3-oxazolidin-4-yl]propyl]carbamate (CAS 96165-58-1) is a chemical compound with the molecular formula C11H18N2O5 and a molecular weight of 258.27 g/mol. IUPAC name: tert-butyl N-[3-[(4S)-2,5-dioxo-1,3-oxazolidin-4-yl]propyl]carbamate. InChIKey: NJUWWDKWBAQLNA-ZETCQYMHSA-N.
| Molecular formula | C11H18N2O5 |
|---|---|
| Molecular weight | 258.27 g/mol |
| IUPAC name | tert-butyl N-[3-[(4S)-2,5-dioxo-1,3-oxazolidin-4-yl]propyl]carbamate |
| InChIKey | NJUWWDKWBAQLNA-ZETCQYMHSA-N |
| SMILES | CC(C)(C)OC(=O)NCCC[C@H]1C(=O)OC(=O)N1 |
Computed by PubChem (NCBI)