CAS 315493-43-7 appears in our catalog under these names: 1-tert-Butyl 3-methyl 5-oxopiperazine-1,3-dicarboxylate, 95%, 1–tert–Butyl 3–methyl 5–oxopiperazine–1,3–dicarboxylate, 1-tert-Butyl 3-methyl 5-oxopiperazine-1,3-dicarboxylate 96%, 1-tert-Butyl 3-methyl 5-oxopiperazine-1,3-dicarboxylate, 96%, 96%, 1-tert-Butyl 3-methyl 5-oxopiperazine-1,3-dicarboxylate, 96%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 250mg, 5g, 10g.
1-O-tert-butyl 3-O-methyl 5-oxopiperazine-1,3-dicarboxylate (CAS 315493-43-7) is a chemical compound with the molecular formula C11H18N2O5 and a molecular weight of 258.27 g/mol. IUPAC name: 1-O-tert-butyl 3-O-methyl 5-oxopiperazine-1,3-dicarboxylate. InChIKey: FQTDIZOVFWSTBE-UHFFFAOYSA-N.
| Molecular formula | C11H18N2O5 |
|---|---|
| Molecular weight | 258.27 g/mol |
| IUPAC name | 1-O-tert-butyl 3-O-methyl 5-oxopiperazine-1,3-dicarboxylate |
| InChIKey | FQTDIZOVFWSTBE-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC(NC(=O)C1)C(=O)OC |
Computed by PubChem (NCBI)