CAS 54998-35-5 appears in our catalog under these names: Ethyl 3-methylbenzimidate hydrochloride, 95%, Ethyl 3–methylbenzene–1–carboximidate hydrochloride. Offered by: Combi-blocks, GLPBio. Available pack sizes: 1g, 5g, 100mg, 250mg.
Ethyl 3-methylbenzenecarboximidate;hydrochloride (CAS 54998-35-5) is a chemical compound with the molecular formula C10H14ClNO and a molecular weight of 199.68 g/mol. IUPAC name: ethyl 3-methylbenzenecarboximidate;hydrochloride. InChIKey: JUNVYEHEQAUNGR-UHFFFAOYSA-N.
| Molecular formula | C10H14ClNO |
|---|---|
| Molecular weight | 199.68 g/mol |
| IUPAC name | ethyl 3-methylbenzenecarboximidate;hydrochloride |
| InChIKey | JUNVYEHEQAUNGR-UHFFFAOYSA-N |
| SMILES | CCOC(=N)C1=CC=CC(=C1)C.Cl |
Computed by PubChem (NCBI)