Products 55062-34-5
CAS 55062-34-5 is the registry number for TDD. Offered by: MedChemExpress. Available pack sizes: Get quote.
(3Z)-3-ethylidene-6-(1H-indol-3-ylmethyl)-1-methylpiperazine-2,5-dione (CAS 55062-34-5) is a chemical compound with the molecular formula C16H17N3O2 and a molecular weight of 283.32 g/mol. IUPAC name: (3Z)-3-ethylidene-6-(1H-indol-3-ylmethyl)-1-methylpiperazine-2,5-dione. InChIKey: LIHMCRDYZWJENE-BASWHVEKSA-N.
| Molecular formula | C16H17N3O2 |
|---|---|
| Molecular weight | 283.32 g/mol |
| IUPAC name | (3Z)-3-ethylidene-6-(1H-indol-3-ylmethyl)-1-methylpiperazine-2,5-dione |
| InChIKey | LIHMCRDYZWJENE-BASWHVEKSA-N |
| SMILES | C/C=C\1/C(=O)N(C(C(=O)N1)CC2=CNC3=CC=CC=C32)C |
Computed by PubChem (NCBI)