Products 55121-08-9

CAS 55121-08-9 is the registry number for 4-Chlorophenethyl isocyanate, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 1g, 5g, 250mg.

Structural formula: {0} (CAS {1})

1-chloro-4-(2-isocyanatoethyl)benzene (CAS 55121-08-9) is a chemical compound with the molecular formula C9H8ClNO and a molecular weight of 181.62 g/mol. IUPAC name: 1-chloro-4-(2-isocyanatoethyl)benzene. InChIKey: UFGOQTFPJKUOBH-UHFFFAOYSA-N.

Identity
Molecular formulaC9H8ClNO
Molecular weight181.62 g/mol
IUPAC name1-chloro-4-(2-isocyanatoethyl)benzene
InChIKeyUFGOQTFPJKUOBH-UHFFFAOYSA-N
SMILESC1=CC(=CC=C1CCN=C=O)Cl

Computed by PubChem (NCBI)