Products 55217-13-5
CAS 55217-13-5 appears in our catalog under these names: Oxaprozin Impurity 4, 4-Oxo-4-((2-oxo-1,2-diphenylethyl)amino)-butanoic Acid. Offered by: Hubei YoungXin, TRC. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg, 250mg.
4-oxo-4-[(2-oxo-1,2-diphenylethyl)amino]butanoic acid (CAS 55217-13-5) is a chemical compound with the molecular formula C18H17NO4 and a molecular weight of 311.3 g/mol. IUPAC name: 4-oxo-4-[(2-oxo-1,2-diphenylethyl)amino]butanoic acid. InChIKey: DWTJSWZBVRWCKG-UHFFFAOYSA-N.
| Molecular formula | C18H17NO4 |
|---|---|
| Molecular weight | 311.3 g/mol |
| IUPAC name | 4-oxo-4-[(2-oxo-1,2-diphenylethyl)amino]butanoic acid |
| InChIKey | DWTJSWZBVRWCKG-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(C(=O)C2=CC=CC=C2)NC(=O)CCC(=O)O |
Computed by PubChem (NCBI)