Products 5542-49-4
CAS 5542-49-4 appears in our catalog under these names: Piperidin-1-yl benzoate, 95-<97%, Piperidin-1-yl benzoate, ≥97-<99%, Piperidin-1-yl benzoate 97%, piperidin-1-yl benzoate, 97%, 97%. Offered by: Hoffman Fine Chemicals, Ambeed, Chemat. Available pack sizes: 5g, 10g, 25g, 50g, 100g, 100mg, 250mg, 1g.
Piperidin-1-yl benzoate (CAS 5542-49-4) is a chemical compound with the molecular formula C12H15NO2 and a molecular weight of 205.25 g/mol. IUPAC name: piperidin-1-yl benzoate. InChIKey: XXZBTNPVRWWWPI-UHFFFAOYSA-N.
| Molecular formula | C12H15NO2 |
|---|---|
| Molecular weight | 205.25 g/mol |
| IUPAC name | piperidin-1-yl benzoate |
| InChIKey | XXZBTNPVRWWWPI-UHFFFAOYSA-N |
| SMILES | C1CCN(CC1)OC(=O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)