CAS 554405-53-7 appears in our catalog under these names: 1-(3,4-Dimethoxy-phenyl)-pyrrole-2,5-dione, 95%, 1-(3,4-Dimethoxyphenyl)-2,5-dihydro-1H-pyrrole-2,5-dione, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
1-(3,4-dimethoxyphenyl)pyrrole-2,5-dione (CAS 554405-53-7) is a chemical compound with the molecular formula C12H11NO4 and a molecular weight of 233.22 g/mol. IUPAC name: 1-(3,4-dimethoxyphenyl)pyrrole-2,5-dione. InChIKey: FOGSUFVHERDFDM-UHFFFAOYSA-N.
| Molecular formula | C12H11NO4 |
|---|---|
| Molecular weight | 233.22 g/mol |
| IUPAC name | 1-(3,4-dimethoxyphenyl)pyrrole-2,5-dione |
| InChIKey | FOGSUFVHERDFDM-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)N2C(=O)C=CC2=O)OC |
Computed by PubChem (NCBI)